C14H20N2O2S — CID 63251986
N-(2-aminocyclopentyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 63251986) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-(2-aminocyclopentyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(2-aminocyclopentyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 63251986 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-(2-aminocyclopentyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | NC1CCCC1NS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H20N2O2S/c15-13-5-2-6-14(13)16-19(17,18)12-8-7-10-3-1-4-11(10)9-12/h7-9,13-14,16H,1-6,15H2 |
| InChIKey | QHIZUKRTWNETLI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |