C13H19BrN2O2S — CID 97168887
N-[(1S,2S)-2-aminocyclohexyl]-3-(bromomethyl)benzenesulfonamide (PubChem CID 97168887) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is N-[(1S,2S)-2-aminocyclohexyl]-3-(bromomethyl)benzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-aminocyclohexyl]-3-(bromomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 97168887 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-[(1S,2S)-2-aminocyclohexyl]-3-(bromomethyl)benzenesulfonamide |
| SMILES | N[C@H]1CCCC[C@@H]1NS(=O)(=O)c1cccc(CBr)c1 |
| InChI | InChI=1S/C13H19BrN2O2S/c14-9-10-4-3-5-11(8-10)19(17,18)16-13-7-2-1-6-12(13)15/h3-5,8,12-13,16H,1-2,6-7,9,15H2/t12-,13-/m0/s1 |
| InChIKey | AAQYWNLVHCYQEF-STQMWFEESA-N |
| XLogP | 2.13 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|