C14H18FNO4S — CID 146137516
2-[3-[[(1R,2R)-2-fluorocyclohexyl]sulfamoyl]phenyl]acetic acid (PubChem CID 146137516) has the molecular formula C14H18FNO4S and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[3-[[(1R,2R)-2-fluorocyclohexyl]sulfamoyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[(1R,2R)-2-fluorocyclohexyl]sulfamoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 146137516 |
| Molecular Formula | C14H18FNO4S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[3-[[(1R,2R)-2-fluorocyclohexyl]sulfamoyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2F)c1 |
| InChI | InChI=1S/C14H18FNO4S/c15-12-6-1-2-7-13(12)16-21(19,20)11-5-3-4-10(8-11)9-14(17)18/h3-5,8,12-13,16H,1-2,6-7,9H2,(H,17,18)/t12-,13-/m1/s1 |
| InChIKey | PJRKFPPQAAISNE-CHWSQXEVSA-N |
| XLogP | 1.87 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |