C24H30N4O10S2 — CID 67245179
2-[3-[6-[[3-(carboxymethyl)phenyl]sulfonylcarbamoylamino]hexylcarbamoylsulfamoyl]phenyl]acetic acid (PubChem CID 67245179) has the molecular formula C24H30N4O10S2 and a molecular weight of 598.66 g/mol. Its IUPAC name is 2-[3-[6-[[3-(carboxymethyl)phenyl]sulfonylcarbamoylamino]hexylcarbamoylsulfamoyl]phenyl]acetic acid.
| Compound Name | 2-[3-[6-[[3-(carboxymethyl)phenyl]sulfonylcarbamoylamino]hexylcarbamoylsulfamoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 67245179 |
| Molecular Formula | C24H30N4O10S2 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 2-[3-[6-[[3-(carboxymethyl)phenyl]sulfonylcarbamoylamino]hexylcarbamoylsulfamoyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(S(=O)(=O)NC(=O)NCCCCCCNC(=O)NS(=O)(=O)c2cccc(CC(=O)O)c2)c1 |
| InChI | InChI=1S/C24H30N4O10S2/c29-21(30)15-17-7-5-9-19(13-17)39(35,36)27-23(33)25-11-3-1-2-4-12-26-24(34)28-40(37,38)20-10-6-8-18(14-20)16-22(31)32/h5-10,13-14H,1-4,11-12,15-16H2,(H,29,30)(H,31,32)(H2,25,27,33)(H2,26,28,34) |
| InChIKey | DJAYEVSRBYMZAD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 225.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|