C9H11ClN2O3S2 — CID 44587907
1-(3-chlorophenyl)sulfonyl-3-(2-sulfanylethyl)urea (PubChem CID 44587907) has the molecular formula C9H11ClN2O3S2 and a molecular weight of 294.79 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-3-(2-sulfanylethyl)urea.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-3-(2-sulfanylethyl)urea |
|---|---|
| PubChem CID | 44587907 |
| Molecular Formula | C9H11ClN2O3S2 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-3-(2-sulfanylethyl)urea |
| SMILES | O=C(NCCS)NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H11ClN2O3S2/c10-7-2-1-3-8(6-7)17(14,15)12-9(13)11-4-5-16/h1-3,6,16H,4-5H2,(H2,11,12,13) |
| InChIKey | YWLFBRWNQUUQLS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|