C13H10Cl2N2O5S2 — CID 155928665
1,3-bis[(3-chlorophenyl)sulfonyl]urea (PubChem CID 155928665) has the molecular formula C13H10Cl2N2O5S2 and a molecular weight of 409.27 g/mol. Its IUPAC name is 1,3-bis[(3-chlorophenyl)sulfonyl]urea.
| Compound Name | 1,3-bis[(3-chlorophenyl)sulfonyl]urea |
|---|---|
| PubChem CID | 155928665 |
| Molecular Formula | C13H10Cl2N2O5S2 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | 1,3-bis[(3-chlorophenyl)sulfonyl]urea |
| SMILES | O=C(NS(=O)(=O)c1cccc(Cl)c1)NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N2O5S2/c14-9-3-1-5-11(7-9)23(19,20)16-13(18)17-24(21,22)12-6-2-4-10(15)8-12/h1-8H,(H2,16,17,18) |
| InChIKey | QRXWGOVBFWNIHQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |