About [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea
[(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea (PubChem CID 177035624) has the molecular formula C8H9ClN2O2S
and a molecular weight of 232.69 g/mol. Its IUPAC name is [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea.
Molecular Properties
| Compound Name | [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea |
| PubChem CID | 177035624 |
| Molecular Formula | C8H9ClN2O2S |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea |
| SMILES | C=S(=O)(NC(N)=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H9ClN2O2S/c1-14(13,11-8(10)12)7-4-2-3-6(9)5-7/h2-5H,1H2,(H3,10,11,12,13) |
| InChIKey | KDJITFZEDUEPDU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea?
The IUPAC name of [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea (CID 177035624) is [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea.
What is the SMILES notation for [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea?
The canonical SMILES for [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea is C=S(=O)(NC(N)=O)c1cccc(Cl)c1.
What is the InChIKey of [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea?
The InChIKey is KDJITFZEDUEPDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2O2S/c1-14(13,11-8(10)12)7-4-2-3-6(9)5-7/h2-5H,1H2,(H3,10,11,12,13).
What are the key properties of [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea?
[(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea has a molecular weight of 232.69 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]urea is sourced from PubChem (CID 177035624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).