C14H14ClN3O2S — CID 91149962
1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-(3-chlorophenyl)urea (PubChem CID 91149962) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 91149962 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-(3-chlorophenyl)urea |
| SMILES | C=S(=O)(NC(=O)Nc1cccc(Cl)c1)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H14ClN3O2S/c1-21(20,13-7-5-11(16)6-8-13)18-14(19)17-12-4-2-3-10(15)9-12/h2-9H,1,16H2,(H2,17,18,19,20) |
| InChIKey | KOVFOPFYRWZSOG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|