C13H14N4O2S — CID 91073286
1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-pyridin-3-ylurea (PubChem CID 91073286) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 91073286 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-pyridin-3-ylurea |
| SMILES | C=S(=O)(NC(=O)Nc1cccnc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H14N4O2S/c1-20(19,12-6-4-10(14)5-7-12)17-13(18)16-11-3-2-8-15-9-11/h2-9H,1,14H2,(H2,16,17,18,19) |
| InChIKey | VSDBEJWMWWYZNP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|