C12H11Cl2N3O7S2 — CID 45156234
3-chloro-4-(pyridin-3-ylcarbamoylamino)benzenesulfonyl chloride;sulfuric acid (PubChem CID 45156234) has the molecular formula C12H11Cl2N3O7S2 and a molecular weight of 444.27 g/mol. Its IUPAC name is 3-chloro-4-(pyridin-3-ylcarbamoylamino)benzenesulfonyl chloride;sulfuric acid.
| Compound Name | 3-chloro-4-(pyridin-3-ylcarbamoylamino)benzenesulfonyl chloride;sulfuric acid |
|---|---|
| PubChem CID | 45156234 |
| Molecular Formula | C12H11Cl2N3O7S2 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | 3-chloro-4-(pyridin-3-ylcarbamoylamino)benzenesulfonyl chloride;sulfuric acid |
| SMILES | O=C(Nc1cccnc1)Nc1ccc(S(=O)(=O)Cl)cc1Cl.O=S(=O)(O)O |
| InChI | InChI=1S/C12H9Cl2N3O3S.H2O4S/c13-10-6-9(21(14,19)20)3-4-11(10)17-12(18)16-8-2-1-5-15-7-8;1-5(2,3)4/h1-7H,(H2,16,17,18);(H2,1,2,3,4) |
| InChIKey | RHPWQLABXYKPEY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|