C14H10Cl3N3O — CID 110536315
1-(3-chlorophenyl)-3-[(Z)-(2,6-dichlorophenyl)methylideneamino]urea (PubChem CID 110536315) has the molecular formula C14H10Cl3N3O and a molecular weight of 342.61 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(Z)-(2,6-dichlorophenyl)methylideneamino]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(Z)-(2,6-dichlorophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 110536315 |
| Molecular Formula | C14H10Cl3N3O |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(Z)-(2,6-dichlorophenyl)methylideneamino]urea |
| SMILES | O=C(N/N=C\c1c(Cl)cccc1Cl)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H10Cl3N3O/c15-9-3-1-4-10(7-9)19-14(21)20-18-8-11-12(16)5-2-6-13(11)17/h1-8H,(H2,19,20,21)/b18-8- |
| InChIKey | VKZSFLCTNCHMQS-LSCVHKIXSA-N |
| XLogP | 4.80 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|