C15H17N3O3S — CID 91476086
1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-(4-methoxyphenyl)urea (PubChem CID 91476086) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 91476086 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-[(4-aminophenyl)-methylidene-oxo-λ6-sulfanyl]-3-(4-methoxyphenyl)urea |
| SMILES | C=S(=O)(NC(=O)Nc1ccc(OC)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H17N3O3S/c1-21-13-7-5-12(6-8-13)17-15(19)18-22(2,20)14-9-3-11(16)4-10-14/h3-10H,2,16H2,1H3,(H2,17,18,19,20) |
| InChIKey | LGXYMMWDRGRXSD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|