C18H20Cl2N4O7S2 — CID 44587806
1-(3-chlorophenyl)sulfonyl-3-[2-[2-[(3-chlorophenyl)sulfonylcarbamoylamino]ethoxy]ethyl]urea (PubChem CID 44587806) has the molecular formula C18H20Cl2N4O7S2 and a molecular weight of 539.42 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-3-[2-[2-[(3-chlorophenyl)sulfonylcarbamoylamino]ethoxy]ethyl]urea.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-3-[2-[2-[(3-chlorophenyl)sulfonylcarbamoylamino]ethoxy]ethyl]urea |
|---|---|
| PubChem CID | 44587806 |
| Molecular Formula | C18H20Cl2N4O7S2 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-3-[2-[2-[(3-chlorophenyl)sulfonylcarbamoylamino]ethoxy]ethyl]urea |
| SMILES | O=C(NCCOCCNC(=O)NS(=O)(=O)c1cccc(Cl)c1)NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2N4O7S2/c19-13-3-1-5-15(11-13)32(27,28)23-17(25)21-7-9-31-10-8-22-18(26)24-33(29,30)16-6-2-4-14(20)12-16/h1-6,11-12H,7-10H2,(H2,21,23,25)(H2,22,24,26) |
| InChIKey | RYSWFLBTSSLJCV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|