C24H30N4O10S2 — CID 24963668
[3-[6-[(3-acetyloxyphenyl)sulfonylcarbamoylamino]hexylcarbamoylsulfamoyl]phenyl] acetate (PubChem CID 24963668) has the molecular formula C24H30N4O10S2 and a molecular weight of 598.66 g/mol. Its IUPAC name is [3-[6-[(3-acetyloxyphenyl)sulfonylcarbamoylamino]hexylcarbamoylsulfamoyl]phenyl] acetate.
| Compound Name | [3-[6-[(3-acetyloxyphenyl)sulfonylcarbamoylamino]hexylcarbamoylsulfamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 24963668 |
| Molecular Formula | C24H30N4O10S2 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | [3-[6-[(3-acetyloxyphenyl)sulfonylcarbamoylamino]hexylcarbamoylsulfamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(S(=O)(=O)NC(=O)NCCCCCCNC(=O)NS(=O)(=O)c2cccc(OC(C)=O)c2)c1 |
| InChI | InChI=1S/C24H30N4O10S2/c1-17(29)37-19-9-7-11-21(15-19)39(33,34)27-23(31)25-13-5-3-4-6-14-26-24(32)28-40(35,36)22-12-8-10-20(16-22)38-18(2)30/h7-12,15-16H,3-6,13-14H2,1-2H3,(H2,25,27,31)(H2,26,28,32) |
| InChIKey | SOFFDJZWBFPISV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|