C17H27N3O5S — CID 155797186
tert-butyl N-[4-[(3-methylphenyl)sulfonylcarbamoylamino]butyl]carbamate (PubChem CID 155797186) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is tert-butyl N-[4-[(3-methylphenyl)sulfonylcarbamoylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(3-methylphenyl)sulfonylcarbamoylamino]butyl]carbamate |
|---|---|
| PubChem CID | 155797186 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | tert-butyl N-[4-[(3-methylphenyl)sulfonylcarbamoylamino]butyl]carbamate |
| SMILES | Cc1cccc(S(=O)(=O)NC(=O)NCCCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H27N3O5S/c1-13-8-7-9-14(12-13)26(23,24)20-15(21)18-10-5-6-11-19-16(22)25-17(2,3)4/h7-9,12H,5-6,10-11H2,1-4H3,(H,19,22)(H2,18,20,21) |
| InChIKey | VKPSVXXSWLXYHF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|