C12H17NO3S — CID 47130286
2,2-dimethyl-N-(3-methylphenyl)sulfonylpropanamide (PubChem CID 47130286) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3-methylphenyl)sulfonylpropanamide.
| Compound Name | 2,2-dimethyl-N-(3-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 47130286 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2,2-dimethyl-N-(3-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1cccc(S(=O)(=O)NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C12H17NO3S/c1-9-6-5-7-10(8-9)17(15,16)13-11(14)12(2,3)4/h5-8H,1-4H3,(H,13,14) |
| InChIKey | WMENBEHYLFKGJC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |