C12H13F6N3O3S — CID 11646849
1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[(3-methylphenyl)sulfonylamino]urea (PubChem CID 11646849) has the molecular formula C12H13F6N3O3S and a molecular weight of 393.31 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[(3-methylphenyl)sulfonylamino]urea.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[(3-methylphenyl)sulfonylamino]urea |
|---|---|
| PubChem CID | 11646849 |
| Molecular Formula | C12H13F6N3O3S |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[(3-methylphenyl)sulfonylamino]urea |
| SMILES | Cc1cccc(S(=O)(=O)NNC(=O)NC(C)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F6N3O3S/c1-7-4-3-5-8(6-7)25(23,24)21-20-9(22)19-10(2,11(13,14)15)12(16,17)18/h3-6,21H,1-2H3,(H2,19,20,22) |
| InChIKey | IVHPVIHCXAAOIT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|