C11H9F8N3O3S — CID 11718604
1-[(2,6-difluorophenyl)sulfonylamino]-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea (PubChem CID 11718604) has the molecular formula C11H9F8N3O3S and a molecular weight of 415.26 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)sulfonylamino]-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea.
| Compound Name | 1-[(2,6-difluorophenyl)sulfonylamino]-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea |
|---|---|
| PubChem CID | 11718604 |
| Molecular Formula | C11H9F8N3O3S |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 1-[(2,6-difluorophenyl)sulfonylamino]-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea |
| SMILES | CC(NC(=O)NNS(=O)(=O)c1c(F)cccc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F8N3O3S/c1-9(10(14,15)16,11(17,18)19)20-8(23)21-22-26(24,25)7-5(12)3-2-4-6(7)13/h2-4,22H,1H3,(H2,20,21,23) |
| InChIKey | MXBIDJOFJWPETE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|