C6H9F6N3O3S — CID 11500665
1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(methanesulfonamido)urea (PubChem CID 11500665) has the molecular formula C6H9F6N3O3S and a molecular weight of 317.21 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(methanesulfonamido)urea.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(methanesulfonamido)urea |
|---|---|
| PubChem CID | 11500665 |
| Molecular Formula | C6H9F6N3O3S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(methanesulfonamido)urea |
| SMILES | CC(NC(=O)NNS(C)(=O)=O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H9F6N3O3S/c1-4(5(7,8)9,6(10,11)12)13-3(16)14-15-19(2,17)18/h15H,1-2H3,(H2,13,14,16) |
| InChIKey | HBNOTDLETYYOBF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|