C14H17F6N3O2S — CID 123484035
1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[methyl-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]amino]urea (PubChem CID 123484035) has the molecular formula C14H17F6N3O2S and a molecular weight of 405.36 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[methyl-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]amino]urea.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[methyl-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]amino]urea |
|---|---|
| PubChem CID | 123484035 |
| Molecular Formula | C14H17F6N3O2S |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-[methyl-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]amino]urea |
| SMILES | C=S(=O)(c1ccc(C)cc1)N(C)NC(=O)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H17F6N3O2S/c1-9-5-7-10(8-6-9)26(4,25)23(3)22-11(24)21-12(2,13(15,16)17)14(18,19)20/h5-8H,4H2,1-3H3,(H2,21,22,24) |
| InChIKey | NQICEXXRUHSJQA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|