C11H9F7O5S — CID 89486117
2,2,3,3,4,4,4-heptafluorobutanoic acid;4-methylbenzenesulfonic acid (PubChem CID 89486117) has the molecular formula C11H9F7O5S and a molecular weight of 386.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutanoic acid;4-methylbenzenesulfonic acid.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 89486117 |
| Molecular Formula | C11H9F7O5S |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=C(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8O3S.C4HF7O2/c1-6-2-4-7(5-3-6)11(8,9)10;5-2(6,1(12)13)3(7,8)4(9,10)11/h2-5H,1H3,(H,8,9,10);(H,12,13) |
| InChIKey | NWCSUDUGXWCVHF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|