C15H18F3NO6S — CID 102462880
dimethyl 2-[(2R)-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propyl]propanedioate (PubChem CID 102462880) has the molecular formula C15H18F3NO6S and a molecular weight of 397.37 g/mol. Its IUPAC name is dimethyl 2-[(2R)-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propyl]propanedioate.
| Compound Name | dimethyl 2-[(2R)-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propyl]propanedioate |
|---|---|
| PubChem CID | 102462880 |
| Molecular Formula | C15H18F3NO6S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | dimethyl 2-[(2R)-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propyl]propanedioate |
| SMILES | COC(=O)C(C[C@@H](NS(=O)(=O)c1ccc(C)cc1)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C15H18F3NO6S/c1-9-4-6-10(7-5-9)26(22,23)19-12(15(16,17)18)8-11(13(20)24-2)14(21)25-3/h4-7,11-12,19H,8H2,1-3H3/t12-/m1/s1 |
| InChIKey | ZQKKOCLAMHWLFH-GFCCVEGCSA-N |
| XLogP | 1.56 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|