C16H24N2O6S — CID 10833090
dimethyl (2R,6S)-2-amino-6-[(4-methylphenyl)sulfonylamino]heptanedioate (PubChem CID 10833090) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is dimethyl (2R,6S)-2-amino-6-[(4-methylphenyl)sulfonylamino]heptanedioate.
| Compound Name | dimethyl (2R,6S)-2-amino-6-[(4-methylphenyl)sulfonylamino]heptanedioate |
|---|---|
| PubChem CID | 10833090 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | dimethyl (2R,6S)-2-amino-6-[(4-methylphenyl)sulfonylamino]heptanedioate |
| SMILES | COC(=O)[C@H](N)CCC[C@H](NS(=O)(=O)c1ccc(C)cc1)C(=O)OC |
| InChI | InChI=1S/C16H24N2O6S/c1-11-7-9-12(10-8-11)25(21,22)18-14(16(20)24-3)6-4-5-13(17)15(19)23-2/h7-10,13-14,18H,4-6,17H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | JRHZLOQUJGVQFK-KGLIPLIRSA-N |
| XLogP | 0.49 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |