C13H19NO5S2 — CID 57142661
methyl 2-[(4-methoxyphenyl)sulfonylamino]-5-sulfanylpentanoate (PubChem CID 57142661) has the molecular formula C13H19NO5S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is methyl 2-[(4-methoxyphenyl)sulfonylamino]-5-sulfanylpentanoate.
| Compound Name | methyl 2-[(4-methoxyphenyl)sulfonylamino]-5-sulfanylpentanoate |
|---|---|
| PubChem CID | 57142661 |
| Molecular Formula | C13H19NO5S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | methyl 2-[(4-methoxyphenyl)sulfonylamino]-5-sulfanylpentanoate |
| SMILES | COC(=O)C(CCCS)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H19NO5S2/c1-18-10-5-7-11(8-6-10)21(16,17)14-12(4-3-9-20)13(15)19-2/h5-8,12,14,20H,3-4,9H2,1-2H3 |
| InChIKey | VKUZFTQDIHZJBZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|