C11H16N2O5S — CID 57153558
methyl 3-amino-2-[(4-methoxyphenyl)sulfonylamino]propanoate (PubChem CID 57153558) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is methyl 3-amino-2-[(4-methoxyphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-amino-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 57153558 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | methyl 3-amino-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(CN)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H16N2O5S/c1-17-8-3-5-9(6-4-8)19(15,16)13-10(7-12)11(14)18-2/h3-6,10,13H,7,12H2,1-2H3 |
| InChIKey | TVKRHNDMIKRDAD-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |