C13H21N3O5S — CID 20646766
(2R)-6-amino-N-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]hexanamide (PubChem CID 20646766) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is (2R)-6-amino-N-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]hexanamide.
| Compound Name | (2R)-6-amino-N-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]hexanamide |
|---|---|
| PubChem CID | 20646766 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2R)-6-amino-N-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]hexanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](CCCCN)C(=O)NO)cc1 |
| InChI | InChI=1S/C13H21N3O5S/c1-21-10-5-7-11(8-6-10)22(19,20)16-12(13(17)15-18)4-2-3-9-14/h5-8,12,16,18H,2-4,9,14H2,1H3,(H,15,17)/t12-/m1/s1 |
| InChIKey | HEZJBOXMMJRPNB-GFCCVEGCSA-N |
| XLogP | -0.02 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|