C24H29N3O7S — CID 22644906
N-[5-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]-4-methoxybenzamide (PubChem CID 22644906) has the molecular formula C24H29N3O7S and a molecular weight of 503.58 g/mol. Its IUPAC name is N-[5-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]-4-methoxybenzamide.
| Compound Name | N-[5-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 22644906 |
| Molecular Formula | C24H29N3O7S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[5-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]-4-methoxybenzamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC(CCCCNC(=O)c2ccc(OC)cc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C24H29N3O7S/c1-3-4-17-34-20-12-14-21(15-13-20)35(31,32)27-22(24(29)26-30)7-5-6-16-25-23(28)18-8-10-19(33-2)11-9-18/h8-15,22,27,30H,5-7,16-17H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | URIGWTAVVCLLIJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|