C23H26ClN3O6S — CID 87598589
N-[(5R)-5-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]-4-chlorobenzamide (PubChem CID 87598589) has the molecular formula C23H26ClN3O6S and a molecular weight of 508.00 g/mol. Its IUPAC name is N-[(5R)-5-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]-4-chlorobenzamide.
| Compound Name | N-[(5R)-5-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 87598589 |
| Molecular Formula | C23H26ClN3O6S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | N-[(5R)-5-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]-4-chlorobenzamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N[C@H](CCCCNC(=O)c2ccc(Cl)cc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C23H26ClN3O6S/c1-2-3-16-33-19-11-13-20(14-12-19)34(31,32)27-21(23(29)26-30)6-4-5-15-25-22(28)17-7-9-18(24)10-8-17/h7-14,21,27,30H,4-6,15-16H2,1H3,(H,25,28)(H,26,29)/t21-/m1/s1 |
| InChIKey | DWZMPLDZRFSIBE-OAQYLSRUSA-N |
| XLogP | 2.49 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|