C20H30N4O6S — CID 22644931
2-[(4-but-2-ynoxyphenyl)sulfonylamino]-5-(diethylcarbamoylamino)-N-hydroxypentanamide (PubChem CID 22644931) has the molecular formula C20H30N4O6S and a molecular weight of 454.55 g/mol. Its IUPAC name is 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-5-(diethylcarbamoylamino)-N-hydroxypentanamide.
| Compound Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-5-(diethylcarbamoylamino)-N-hydroxypentanamide |
|---|---|
| PubChem CID | 22644931 |
| Molecular Formula | C20H30N4O6S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-5-(diethylcarbamoylamino)-N-hydroxypentanamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC(CCCNC(=O)N(CC)CC)C(=O)NO)cc1 |
| InChI | InChI=1S/C20H30N4O6S/c1-4-7-15-30-16-10-12-17(13-11-16)31(28,29)23-18(19(25)22-27)9-8-14-21-20(26)24(5-2)6-3/h10-13,18,23,27H,5-6,8-9,14-15H2,1-3H3,(H,21,26)(H,22,25) |
| InChIKey | ODLCMQLEBMCIFB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|