C14H17N3O6S — CID 10316165
2-[(4-but-2-ynoxyphenyl)sulfonylamino]-N-hydroxybutanediamide (PubChem CID 10316165) has the molecular formula C14H17N3O6S and a molecular weight of 355.37 g/mol. Its IUPAC name is 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-N-hydroxybutanediamide.
| Compound Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-N-hydroxybutanediamide |
|---|---|
| PubChem CID | 10316165 |
| Molecular Formula | C14H17N3O6S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-N-hydroxybutanediamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC(CC(N)=O)C(=O)NO)cc1 |
| InChI | InChI=1S/C14H17N3O6S/c1-2-3-8-23-10-4-6-11(7-5-10)24(21,22)17-12(9-13(15)18)14(19)16-20/h4-7,12,17,20H,8-9H2,1H3,(H2,15,18)(H,16,19) |
| InChIKey | UWTDCHNWPQMTLI-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|