C15H18BrNO6S — CID 22645004
3-(2-bromoethoxy)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]propanoic acid (PubChem CID 22645004) has the molecular formula C15H18BrNO6S and a molecular weight of 420.28 g/mol. Its IUPAC name is 3-(2-bromoethoxy)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-(2-bromoethoxy)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 22645004 |
| Molecular Formula | C15H18BrNO6S |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | 3-(2-bromoethoxy)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC(COCCBr)C(=O)O)cc1 |
| InChI | InChI=1S/C15H18BrNO6S/c1-2-3-9-23-12-4-6-13(7-5-12)24(20,21)17-14(15(18)19)11-22-10-8-16/h4-7,14,17H,8-11H2,1H3,(H,18,19) |
| InChIKey | WZAJSUOJOKNISG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|