C23H28N4O7S2 — CID 91382782
2-[(4-but-2-ynoxyphenyl)sulfonylamino]-5-[carbamimidoyl-(4-methylphenyl)sulfonylamino]pentanoic acid (PubChem CID 91382782) has the molecular formula C23H28N4O7S2 and a molecular weight of 536.63 g/mol. Its IUPAC name is 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-5-[carbamimidoyl-(4-methylphenyl)sulfonylamino]pentanoic acid.
| Compound Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-5-[carbamimidoyl-(4-methylphenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 91382782 |
| Molecular Formula | C23H28N4O7S2 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-5-[carbamimidoyl-(4-methylphenyl)sulfonylamino]pentanoic acid |
| SMILES | [H]/N=C(\N)N(CCCC(NS(=O)(=O)c1ccc(OCC#CC)cc1)C(=O)O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H28N4O7S2/c1-3-4-16-34-18-9-13-19(14-10-18)35(30,31)26-21(22(28)29)6-5-15-27(23(24)25)36(32,33)20-11-7-17(2)8-12-20/h7-14,21,26H,5-6,15-16H2,1-2H3,(H3,24,25)(H,28,29) |
| InChIKey | KAPFQGCRLMQHQT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 179.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|