C19H30N4O6S — CID 91884942
(3R)-6-[carbamimidoyl-(4-methylphenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 91884942) has the molecular formula C19H30N4O6S and a molecular weight of 442.54 g/mol. Its IUPAC name is (3R)-6-[carbamimidoyl-(4-methylphenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (3R)-6-[carbamimidoyl-(4-methylphenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 91884942 |
| Molecular Formula | C19H30N4O6S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (3R)-6-[carbamimidoyl-(4-methylphenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | [H]/N=C(\N)N(CCC[C@H](CC(=O)O)NC(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H30N4O6S/c1-13-7-9-15(10-8-13)30(27,28)23(17(20)21)11-5-6-14(12-16(24)25)22-18(26)29-19(2,3)4/h7-10,14H,5-6,11-12H2,1-4H3,(H3,20,21)(H,22,26)(H,24,25)/t14-/m1/s1 |
| InChIKey | OZAUAOMKVNHBOJ-CQSZACIVSA-N |
| XLogP | 2.03 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|