C21H28N2O4S — CID 19757882
tert-butyl N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]carbamate (PubChem CID 19757882) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is tert-butyl N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]carbamate |
|---|---|
| PubChem CID | 19757882 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | tert-butyl N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCNC(=O)OC(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H28N2O4S/c1-17-11-13-19(14-12-17)28(25,26)23(18-9-6-5-7-10-18)16-8-15-22-20(24)27-21(2,3)4/h5-7,9-14H,8,15-16H2,1-4H3,(H,22,24) |
| InChIKey | DTTCFTJNXMFIAG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|