C21H25ClN2O5S — CID 42703056
ethyl 4-[3-(N-(4-chlorophenyl)sulfonylanilino)propylamino]-4-oxobutanoate (PubChem CID 42703056) has the molecular formula C21H25ClN2O5S and a molecular weight of 452.96 g/mol. Its IUPAC name is ethyl 4-[3-(N-(4-chlorophenyl)sulfonylanilino)propylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[3-(N-(4-chlorophenyl)sulfonylanilino)propylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42703056 |
| Molecular Formula | C21H25ClN2O5S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | ethyl 4-[3-(N-(4-chlorophenyl)sulfonylanilino)propylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NCCCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2O5S/c1-2-29-21(26)14-13-20(25)23-15-6-16-24(18-7-4-3-5-8-18)30(27,28)19-11-9-17(22)10-12-19/h3-5,7-12H,2,6,13-16H2,1H3,(H,23,25) |
| InChIKey | RKOOTKGWVRUCKE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|