C31H48N2O4S — CID 19757897
tert-butyl N-decyl-N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]carbamate (PubChem CID 19757897) has the molecular formula C31H48N2O4S and a molecular weight of 544.80 g/mol. Its IUPAC name is tert-butyl N-decyl-N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]carbamate.
| Compound Name | tert-butyl N-decyl-N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]carbamate |
|---|---|
| PubChem CID | 19757897 |
| Molecular Formula | C31H48N2O4S |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | tert-butyl N-decyl-N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]carbamate |
| SMILES | CCCCCCCCCCN(CCCN(c1ccccc1)S(=O)(=O)c1ccc(C)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H48N2O4S/c1-6-7-8-9-10-11-12-16-24-32(30(34)37-31(3,4)5)25-17-26-33(28-18-14-13-15-19-28)38(35,36)29-22-20-27(2)21-23-29/h13-15,18-23H,6-12,16-17,24-26H2,1-5H3 |
| InChIKey | WNQWNPWSFFCREU-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|