C33H36N2O7S2 — CID 68672265
5-[4-[hexyl-(4-methylphenyl)sulfonylamino]phenoxy]-2-(4-methyl-N-sulfinoanilino)benzoic acid (PubChem CID 68672265) has the molecular formula C33H36N2O7S2 and a molecular weight of 636.79 g/mol. Its IUPAC name is 5-[4-[hexyl-(4-methylphenyl)sulfonylamino]phenoxy]-2-(4-methyl-N-sulfinoanilino)benzoic acid.
| Compound Name | 5-[4-[hexyl-(4-methylphenyl)sulfonylamino]phenoxy]-2-(4-methyl-N-sulfinoanilino)benzoic acid |
|---|---|
| PubChem CID | 68672265 |
| Molecular Formula | C33H36N2O7S2 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | 5-[4-[hexyl-(4-methylphenyl)sulfonylamino]phenoxy]-2-(4-methyl-N-sulfinoanilino)benzoic acid |
| SMILES | CCCCCCN(c1ccc(Oc2ccc(N(c3ccc(C)cc3)S(=O)O)c(C(=O)O)c2)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H36N2O7S2/c1-4-5-6-7-22-34(44(40,41)30-19-10-25(3)11-20-30)26-14-16-28(17-15-26)42-29-18-21-32(31(23-29)33(36)37)35(43(38)39)27-12-8-24(2)9-13-27/h8-21,23H,4-7,22H2,1-3H3,(H,36,37)(H,38,39) |
| InChIKey | QESDMMNZEMMOSI-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|