C24H24N2O8S — CID 68672702
2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)-4-(4-nitro-3-propoxyphenoxy)benzene (PubChem CID 68672702) has the molecular formula C24H24N2O8S and a molecular weight of 500.53 g/mol. Its IUPAC name is 2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)-4-(4-nitro-3-propoxyphenoxy)benzene.
| Compound Name | 2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)-4-(4-nitro-3-propoxyphenoxy)benzene |
|---|---|
| PubChem CID | 68672702 |
| Molecular Formula | C24H24N2O8S |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)-4-(4-nitro-3-propoxyphenoxy)benzene |
| SMILES | CCCOc1cc(Oc2ccc(N(c3ccc(C)cc3)S(=O)O)c(C(=O)OC)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H24N2O8S/c1-4-13-33-23-15-19(10-12-22(23)26(28)29)34-18-9-11-21(20(14-18)24(27)32-3)25(35(30)31)17-7-5-16(2)6-8-17/h5-12,14-15H,4,13H2,1-3H3,(H,30,31) |
| InChIKey | LGZCFNRFSYLHAO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|