C21H17ClN2O7S — CID 68671944
4-(3-chloro-4-nitrophenoxy)-2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)benzene (PubChem CID 68671944) has the molecular formula C21H17ClN2O7S and a molecular weight of 476.89 g/mol. Its IUPAC name is 4-(3-chloro-4-nitrophenoxy)-2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)benzene.
| Compound Name | 4-(3-chloro-4-nitrophenoxy)-2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)benzene |
|---|---|
| PubChem CID | 68671944 |
| Molecular Formula | C21H17ClN2O7S |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 4-(3-chloro-4-nitrophenoxy)-2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)benzene |
| SMILES | COC(=O)c1cc(Oc2ccc([N+](=O)[O-])c(Cl)c2)ccc1N(c1ccc(C)cc1)S(=O)O |
| InChI | InChI=1S/C21H17ClN2O7S/c1-13-3-5-14(6-4-13)23(32(28)29)19-9-7-15(11-17(19)21(25)30-2)31-16-8-10-20(24(26)27)18(22)12-16/h3-12H,1-2H3,(H,28,29) |
| InChIKey | BGWCAXVPLCUTMT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|