C31H32N2O8S2 — CID 68671429
2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)-4-[4-(4-methyl-N-sulfinoanilino)-3-propoxyphenoxy]benzene (PubChem CID 68671429) has the molecular formula C31H32N2O8S2 and a molecular weight of 624.74 g/mol. Its IUPAC name is 2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)-4-[4-(4-methyl-N-sulfinoanilino)-3-propoxyphenoxy]benzene.
| Compound Name | 2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)-4-[4-(4-methyl-N-sulfinoanilino)-3-propoxyphenoxy]benzene |
|---|---|
| PubChem CID | 68671429 |
| Molecular Formula | C31H32N2O8S2 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | 2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)-4-[4-(4-methyl-N-sulfinoanilino)-3-propoxyphenoxy]benzene |
| SMILES | CCCOc1cc(Oc2ccc(N(c3ccc(C)cc3)S(=O)O)c(C(=O)OC)c2)ccc1N(c1ccc(C)cc1)S(=O)O |
| InChI | InChI=1S/C31H32N2O8S2/c1-5-18-40-30-20-26(15-17-29(30)33(43(37)38)24-12-8-22(3)9-13-24)41-25-14-16-28(27(19-25)31(34)39-4)32(42(35)36)23-10-6-21(2)7-11-23/h6-17,19-20H,5,18H2,1-4H3,(H,35,36)(H,37,38) |
| InChIKey | MATDMBUEVDBCAI-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|