C30H29N3O7S2-2 — CID 68672082
4-[3-(ethylamino)-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)benzene (PubChem CID 68672082) has the molecular formula C30H29N3O7S2-2 and a molecular weight of 607.71 g/mol. Its IUPAC name is 4-[3-(ethylamino)-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)benzene.
| Compound Name | 4-[3-(ethylamino)-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)benzene |
|---|---|
| PubChem CID | 68672082 |
| Molecular Formula | C30H29N3O7S2-2 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | 4-[3-(ethylamino)-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)benzene |
| SMILES | CCNc1cc(Oc2ccc(N(c3ccc(C)cc3)S(=O)[O-])c(C(=O)OC)c2)ccc1N(c1ccc(C)cc1)S(=O)[O-] |
| InChI | InChI=1S/C30H31N3O7S2/c1-5-31-27-19-25(15-17-29(27)33(42(37)38)23-12-8-21(3)9-13-23)40-24-14-16-28(26(18-24)30(34)39-4)32(41(35)36)22-10-6-20(2)7-11-22/h6-19,31H,5H2,1-4H3,(H,35,36)(H,37,38)/p-2 |
| InChIKey | UZXPKOMNLCCULX-UHFFFAOYSA-L |
| XLogP | 6.18 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|