C34H29N3O7S2-2 — CID 68672439
4-[3-(benzylamino)-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-carboxy-1-(4-methyl-N-sulfinatoanilino)benzene (PubChem CID 68672439) has the molecular formula C34H29N3O7S2-2 and a molecular weight of 655.75 g/mol. Its IUPAC name is 4-[3-(benzylamino)-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-carboxy-1-(4-methyl-N-sulfinatoanilino)benzene.
| Compound Name | 4-[3-(benzylamino)-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-carboxy-1-(4-methyl-N-sulfinatoanilino)benzene |
|---|---|
| PubChem CID | 68672439 |
| Molecular Formula | C34H29N3O7S2-2 |
| Molecular Weight | 655.75 g/mol |
| Exact Mass | 655.15 |
| IUPAC Name | 4-[3-(benzylamino)-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-carboxy-1-(4-methyl-N-sulfinatoanilino)benzene |
| SMILES | Cc1ccc(N(c2ccc(Oc3ccc(N(c4ccc(C)cc4)S(=O)[O-])c(C(=O)O)c3)cc2NCc2ccccc2)S(=O)[O-])cc1 |
| InChI | InChI=1S/C34H31N3O7S2/c1-23-8-12-26(13-9-23)36(45(40)41)32-18-16-28(20-30(32)34(38)39)44-29-17-19-33(31(21-29)35-22-25-6-4-3-5-7-25)37(46(42)43)27-14-10-24(2)11-15-27/h3-21,35H,22H2,1-2H3,(H,38,39)(H,40,41)(H,42,43)/p-2 |
| InChIKey | YDJKEDUDHJGZKM-UHFFFAOYSA-L |
| XLogP | 7.27 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.75 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|