C27H23N2O5S- — CID 68671377
1-amino-4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-phenylbenzene (PubChem CID 68671377) has the molecular formula C27H23N2O5S- and a molecular weight of 487.56 g/mol. Its IUPAC name is 1-amino-4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-phenylbenzene.
| Compound Name | 1-amino-4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-phenylbenzene |
|---|---|
| PubChem CID | 68671377 |
| Molecular Formula | C27H23N2O5S- |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 1-amino-4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinatoanilino)phenoxy]-2-phenylbenzene |
| SMILES | COC(=O)c1cc(Oc2ccc(N)c(-c3ccccc3)c2)ccc1N(c1ccc(C)cc1)S(=O)[O-] |
| InChI | InChI=1S/C27H24N2O5S/c1-18-8-10-20(11-9-18)29(35(31)32)26-15-13-22(17-24(26)27(30)33-2)34-21-12-14-25(28)23(16-21)19-6-4-3-5-7-19/h3-17H,28H2,1-2H3,(H,31,32)/p-1 |
| InChIKey | DGTDXFGJZWCKIA-UHFFFAOYSA-M |
| XLogP | 5.76 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|