C34H28N2O7S2-2 — CID 68672223
2-benzyl-4-[3-carboxy-4-(4-methyl-N-sulfinatoanilino)phenoxy]-1-(4-methyl-N-sulfinatoanilino)benzene (PubChem CID 68672223) has the molecular formula C34H28N2O7S2-2 and a molecular weight of 640.74 g/mol. Its IUPAC name is 2-benzyl-4-[3-carboxy-4-(4-methyl-N-sulfinatoanilino)phenoxy]-1-(4-methyl-N-sulfinatoanilino)benzene.
| Compound Name | 2-benzyl-4-[3-carboxy-4-(4-methyl-N-sulfinatoanilino)phenoxy]-1-(4-methyl-N-sulfinatoanilino)benzene |
|---|---|
| PubChem CID | 68672223 |
| Molecular Formula | C34H28N2O7S2-2 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.13 |
| IUPAC Name | 2-benzyl-4-[3-carboxy-4-(4-methyl-N-sulfinatoanilino)phenoxy]-1-(4-methyl-N-sulfinatoanilino)benzene |
| SMILES | Cc1ccc(N(c2ccc(Oc3ccc(N(c4ccc(C)cc4)S(=O)[O-])c(C(=O)O)c3)cc2Cc2ccccc2)S(=O)[O-])cc1 |
| InChI | InChI=1S/C34H30N2O7S2/c1-23-8-12-27(13-9-23)35(44(39)40)32-18-16-29(21-26(32)20-25-6-4-3-5-7-25)43-30-17-19-33(31(22-30)34(37)38)36(45(41)42)28-14-10-24(2)11-15-28/h3-19,21-22H,20H2,1-2H3,(H,37,38)(H,39,40)(H,41,42)/p-2 |
| InChIKey | KWNFULBESFRRGM-UHFFFAOYSA-L |
| XLogP | 7.25 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|