C30H30N2O8S2 — CID 68671592
2-(4-methyl-N-sulfinoanilino)-5-[4-(4-methyl-N-sulfinoanilino)-3-propoxyphenoxy]benzoic acid (PubChem CID 68671592) has the molecular formula C30H30N2O8S2 and a molecular weight of 610.71 g/mol. Its IUPAC name is 2-(4-methyl-N-sulfinoanilino)-5-[4-(4-methyl-N-sulfinoanilino)-3-propoxyphenoxy]benzoic acid.
| Compound Name | 2-(4-methyl-N-sulfinoanilino)-5-[4-(4-methyl-N-sulfinoanilino)-3-propoxyphenoxy]benzoic acid |
|---|---|
| PubChem CID | 68671592 |
| Molecular Formula | C30H30N2O8S2 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | 2-(4-methyl-N-sulfinoanilino)-5-[4-(4-methyl-N-sulfinoanilino)-3-propoxyphenoxy]benzoic acid |
| SMILES | CCCOc1cc(Oc2ccc(N(c3ccc(C)cc3)S(=O)O)c(C(=O)O)c2)ccc1N(c1ccc(C)cc1)S(=O)O |
| InChI | InChI=1S/C30H30N2O8S2/c1-4-17-39-29-19-25(14-16-28(29)32(42(37)38)23-11-7-21(3)8-12-23)40-24-13-15-27(26(18-24)30(33)34)31(41(35)36)22-9-5-20(2)6-10-22/h5-16,18-19H,4,17H2,1-3H3,(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | GEJKLKZMGMNZQQ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|