C32H32N2O8S2-2 — CID 68672154
2-carboxy-1-(4-methyl-N-sulfinatoanilino)-4-[4-(4-methyl-N-sulfinatoanilino)-3-pentoxyphenoxy]benzene (PubChem CID 68672154) has the molecular formula C32H32N2O8S2-2 and a molecular weight of 636.75 g/mol. Its IUPAC name is 2-carboxy-1-(4-methyl-N-sulfinatoanilino)-4-[4-(4-methyl-N-sulfinatoanilino)-3-pentoxyphenoxy]benzene.
| Compound Name | 2-carboxy-1-(4-methyl-N-sulfinatoanilino)-4-[4-(4-methyl-N-sulfinatoanilino)-3-pentoxyphenoxy]benzene |
|---|---|
| PubChem CID | 68672154 |
| Molecular Formula | C32H32N2O8S2-2 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | 2-carboxy-1-(4-methyl-N-sulfinatoanilino)-4-[4-(4-methyl-N-sulfinatoanilino)-3-pentoxyphenoxy]benzene |
| SMILES | CCCCCOc1cc(Oc2ccc(N(c3ccc(C)cc3)S(=O)[O-])c(C(=O)O)c2)ccc1N(c1ccc(C)cc1)S(=O)[O-] |
| InChI | InChI=1S/C32H34N2O8S2/c1-4-5-6-19-41-31-21-27(16-18-30(31)34(44(39)40)25-13-9-23(3)10-14-25)42-26-15-17-29(28(20-26)32(35)36)33(43(37)38)24-11-7-22(2)8-12-24/h7-18,20-21H,4-6,19H2,1-3H3,(H,35,36)(H,37,38)(H,39,40)/p-2 |
| InChIKey | JGKQHQASDPIWRI-UHFFFAOYSA-L |
| XLogP | 7.23 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|