C28H25N2O5S- — CID 68671363
1-amino-2-benzyl-4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinatoanilino)phenoxy]benzene (PubChem CID 68671363) has the molecular formula C28H25N2O5S- and a molecular weight of 501.58 g/mol. Its IUPAC name is 1-amino-2-benzyl-4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinatoanilino)phenoxy]benzene.
| Compound Name | 1-amino-2-benzyl-4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinatoanilino)phenoxy]benzene |
|---|---|
| PubChem CID | 68671363 |
| Molecular Formula | C28H25N2O5S- |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 1-amino-2-benzyl-4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinatoanilino)phenoxy]benzene |
| SMILES | COC(=O)c1cc(Oc2ccc(N)c(Cc3ccccc3)c2)ccc1N(c1ccc(C)cc1)S(=O)[O-] |
| InChI | InChI=1S/C28H26N2O5S/c1-19-8-10-22(11-9-19)30(36(32)33)27-15-13-24(18-25(27)28(31)34-2)35-23-12-14-26(29)21(17-23)16-20-6-4-3-5-7-20/h3-15,17-18H,16,29H2,1-2H3,(H,32,33)/p-1 |
| InChIKey | DQOMQZIWQFTJIJ-UHFFFAOYSA-M |
| XLogP | 5.68 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|