C28H26N2O5S — CID 59566203
methyl 5-(4-amino-3-benzylphenoxy)-2-[(4-methylphenyl)sulfonylamino]benzoate (PubChem CID 59566203) has the molecular formula C28H26N2O5S and a molecular weight of 502.59 g/mol. Its IUPAC name is methyl 5-(4-amino-3-benzylphenoxy)-2-[(4-methylphenyl)sulfonylamino]benzoate.
| Compound Name | methyl 5-(4-amino-3-benzylphenoxy)-2-[(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 59566203 |
| Molecular Formula | C28H26N2O5S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | methyl 5-(4-amino-3-benzylphenoxy)-2-[(4-methylphenyl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1cc(Oc2ccc(N)c(Cc3ccccc3)c2)ccc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H26N2O5S/c1-19-8-12-24(13-9-19)36(32,33)30-27-15-11-23(18-25(27)28(31)34-2)35-22-10-14-26(29)21(17-22)16-20-6-4-3-5-7-20/h3-15,17-18,30H,16,29H2,1-2H3 |
| InChIKey | BJCJJPBEORAMEY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|