C30H31N3O5S2 — CID 143551248
methyl 5-[3-(ethylamino)-4-[(4-methylphenyl)sulfonylamino]phenoxy]-2-[(4-methylphenyl)sulfanylamino]benzoate (PubChem CID 143551248) has the molecular formula C30H31N3O5S2 and a molecular weight of 577.73 g/mol. Its IUPAC name is methyl 5-[3-(ethylamino)-4-[(4-methylphenyl)sulfonylamino]phenoxy]-2-[(4-methylphenyl)sulfanylamino]benzoate.
| Compound Name | methyl 5-[3-(ethylamino)-4-[(4-methylphenyl)sulfonylamino]phenoxy]-2-[(4-methylphenyl)sulfanylamino]benzoate |
|---|---|
| PubChem CID | 143551248 |
| Molecular Formula | C30H31N3O5S2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | methyl 5-[3-(ethylamino)-4-[(4-methylphenyl)sulfonylamino]phenoxy]-2-[(4-methylphenyl)sulfanylamino]benzoate |
| SMILES | CCNc1cc(Oc2ccc(NSc3ccc(C)cc3)c(C(=O)OC)c2)ccc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H31N3O5S2/c1-5-31-29-19-23(11-17-28(29)33-40(35,36)25-14-8-21(3)9-15-25)38-22-10-16-27(26(18-22)30(34)37-4)32-39-24-12-6-20(2)7-13-24/h6-19,31-33H,5H2,1-4H3 |
| InChIKey | FRSCRJGMKXKXDU-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|