C17H19NO4S — CID 150114167
ethyl 5-methyl-2-[(4-methylphenyl)sulfonylamino]benzoate (PubChem CID 150114167) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is ethyl 5-methyl-2-[(4-methylphenyl)sulfonylamino]benzoate.
| Compound Name | ethyl 5-methyl-2-[(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 150114167 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | ethyl 5-methyl-2-[(4-methylphenyl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1cc(C)ccc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-4-22-17(19)15-11-13(3)7-10-16(15)18-23(20,21)14-8-5-12(2)6-9-14/h5-11,18H,4H2,1-3H3 |
| InChIKey | DXWTXYFRPNBVGM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |